C27H19NO — CID 153450257
2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)-4,5-bis(trideuteriomethyl)pyridine (PubChem CID 153450257) has the molecular formula C27H19NO and a molecular weight of 379.49 g/mol. Its IUPAC name is 2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)-4,5-bis(trideuteriomethyl)pyridine.
| Compound Name | 2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)-4,5-bis(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 153450257 |
| Molecular Formula | C27H19NO |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)-4,5-bis(trideuteriomethyl)pyridine |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2cccc3c2oc2cc4c(ccc5ccccc54)cc23)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C27H19NO/c1-16-12-25(28-15-17(16)2)22-9-5-8-21-24-13-19-11-10-18-6-3-4-7-20(18)23(19)14-26(24)29-27(21)22/h3-15H,1-2H3/i1D3,2D3 |
| InChIKey | LBDCOFDQPDGTNS-WFGJKAKNSA-N |
| XLogP | 7.57 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|