C31H23NO — CID 168731031
2-[6-(4-phenylphenyl)dibenzofuran-4-yl]-4,5-bis(trideuteriomethyl)pyridine (PubChem CID 168731031) has the molecular formula C31H23NO and a molecular weight of 431.57 g/mol. Its IUPAC name is 2-[6-(4-phenylphenyl)dibenzofuran-4-yl]-4,5-bis(trideuteriomethyl)pyridine.
| Compound Name | 2-[6-(4-phenylphenyl)dibenzofuran-4-yl]-4,5-bis(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 168731031 |
| Molecular Formula | C31H23NO |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 2-[6-(4-phenylphenyl)dibenzofuran-4-yl]-4,5-bis(trideuteriomethyl)pyridine |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2cccc3c2oc2c(-c4ccc(-c5ccccc5)cc4)cccc23)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C31H23NO/c1-20-18-29(32-19-21(20)2)28-13-7-12-27-26-11-6-10-25(30(26)33-31(27)28)24-16-14-23(15-17-24)22-8-4-3-5-9-22/h3-19H,1-2H3/i1D3,2D3 |
| InChIKey | OBNFLCHRZBUODG-WFGJKAKNSA-N |
| XLogP | 8.60 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |