C26H25NOSi — CID 171724015
trimethyl-[[2-naphtho[1,2-b][1]benzofuran-10-yl-5-(trideuteriomethyl)-4-pyridinyl]methyl]silane (PubChem CID 171724015) has the molecular formula C26H25NOSi and a molecular weight of 398.60 g/mol. Its IUPAC name is trimethyl-[[2-naphtho[1,2-b][1]benzofuran-10-yl-5-(trideuteriomethyl)-4-pyridinyl]methyl]silane.
| Compound Name | trimethyl-[[2-naphtho[1,2-b][1]benzofuran-10-yl-5-(trideuteriomethyl)-4-pyridinyl]methyl]silane |
|---|---|
| PubChem CID | 171724015 |
| Molecular Formula | C26H25NOSi |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | trimethyl-[[2-naphtho[1,2-b][1]benzofuran-10-yl-5-(trideuteriomethyl)-4-pyridinyl]methyl]silane |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2cccc3c2oc2c4ccccc4ccc32)cc1C[Si](C)(C)C |
| InChI | InChI=1S/C26H25NOSi/c1-17-15-27-24(14-19(17)16-29(2,3)4)23-11-7-10-21-22-13-12-18-8-5-6-9-20(18)25(22)28-26(21)23/h5-15H,16H2,1-4H3/i1D3 |
| InChIKey | JBESKFYSNNQGME-FIBGUPNXSA-N |
| XLogP | 7.53 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|