C36H31NOSi — CID 170546286
[3-deuterio-4-[2-phenanthro[1,2-b][1]benzofuran-10-yl-5-(trideuteriomethyl)-4-pyridinyl]-5-(trideuteriomethyl)phenyl]-trimethylsilane (PubChem CID 170546286) has the molecular formula C36H31NOSi and a molecular weight of 528.78 g/mol. Its IUPAC name is [3-deuterio-4-[2-phenanthro[1,2-b][1]benzofuran-10-yl-5-(trideuteriomethyl)-4-pyridinyl]-5-(trideuteriomethyl)phenyl]-trimethylsilane.
| Compound Name | [3-deuterio-4-[2-phenanthro[1,2-b][1]benzofuran-10-yl-5-(trideuteriomethyl)-4-pyridinyl]-5-(trideuteriomethyl)phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 170546286 |
| Molecular Formula | C36H31NOSi |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | [3-deuterio-4-[2-phenanthro[1,2-b][1]benzofuran-10-yl-5-(trideuteriomethyl)-4-pyridinyl]-5-(trideuteriomethyl)phenyl]-trimethylsilane |
| SMILES | [2H]c1cc([Si](C)(C)C)cc(C([2H])([2H])[2H])c1-c1cc(-c2cccc3c2oc2c3ccc3c4ccccc4ccc32)ncc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C36H31NOSi/c1-22-19-25(39(3,4)5)14-16-26(22)33-20-34(37-21-23(33)2)32-12-8-11-29-31-18-17-28-27-10-7-6-9-24(27)13-15-30(28)35(31)38-36(29)32/h6-21H,1-5H3/i1D3,2D3,16D |
| InChIKey | SOKZBEGFLSYBJF-JXVLEPIESA-N |
| XLogP | 9.78 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|