C36H31NOSi — CID 157408157
trimethyl-[4-[2-(3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16,18,20-decaen-5-yl)-5-(trideuteriomethyl)-4-pyridinyl]-3-(trideuteriomethyl)phenyl]silane (PubChem CID 157408157) has the molecular formula C36H31NOSi and a molecular weight of 527.77 g/mol. Its IUPAC name is trimethyl-[4-[2-(3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16,18,20-decaen-5-yl)-5-(trideuteriomethyl)-4-pyridinyl]-3-(trideuteriomethyl)phenyl]silane.
| Compound Name | trimethyl-[4-[2-(3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16,18,20-decaen-5-yl)-5-(trideuteriomethyl)-4-pyridinyl]-3-(trideuteriomethyl)phenyl]silane |
|---|---|
| PubChem CID | 157408157 |
| Molecular Formula | C36H31NOSi |
| Molecular Weight | 527.77 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | trimethyl-[4-[2-(3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16,18,20-decaen-5-yl)-5-(trideuteriomethyl)-4-pyridinyl]-3-(trideuteriomethyl)phenyl]silane |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2cccc3c2oc2c3ccc3ccc4ccccc4c32)cc1-c1ccc([Si](C)(C)C)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C36H31NOSi/c1-22-19-26(39(3,4)5)16-18-27(22)32-20-33(37-21-23(32)2)31-12-8-11-29-30-17-15-25-14-13-24-9-6-7-10-28(24)34(25)36(30)38-35(29)31/h6-21H,1-5H3/i1D3,2D3 |
| InChIKey | FVSJXMHCGLMETL-WFGJKAKNSA-N |
| XLogP | 9.78 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.77 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|