C37H35NO — CID 176846616
4-(3-deuteriospiro[5.5]undecan-3-yl)-2-(3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16,18,20-decaen-5-yl)-5-(trideuteriomethyl)pyridine (PubChem CID 176846616) has the molecular formula C37H35NO and a molecular weight of 513.72 g/mol. Its IUPAC name is 4-(3-deuteriospiro[5.5]undecan-3-yl)-2-(3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16,18,20-decaen-5-yl)-5-(trideuteriomethyl)pyridine.
| Compound Name | 4-(3-deuteriospiro[5.5]undecan-3-yl)-2-(3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16,18,20-decaen-5-yl)-5-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 176846616 |
| Molecular Formula | C37H35NO |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | 4-(3-deuteriospiro[5.5]undecan-3-yl)-2-(3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16,18,20-decaen-5-yl)-5-(trideuteriomethyl)pyridine |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2cccc3c2oc2c3ccc3ccc4ccccc4c32)cc1C1([2H])CCC2(CCCCC2)CC1 |
| InChI | InChI=1S/C37H35NO/c1-24-23-38-33(22-32(24)26-16-20-37(21-17-26)18-5-2-6-19-37)31-11-7-10-29-30-15-14-27-13-12-25-8-3-4-9-28(25)34(27)36(30)39-35(29)31/h3-4,7-15,22-23,26H,2,5-6,16-21H2,1H3/i1D3,26D |
| InChIKey | QWQJSJORJBODAP-FFXBUATQSA-N |
| XLogP | 10.87 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|