C52H51FIrN2OSi-2 — CID 169301419
CID 169301419 (PubChem CID 169301419) has the molecular formula C52H51FIrN2OSi-2 and a molecular weight of 963.32 g/mol.
| Compound Name | CID 169301419 |
|---|---|
| PubChem CID | 169301419 |
| Molecular Formula | C52H51FIrN2OSi-2 |
| Molecular Weight | 963.32 g/mol |
| Exact Mass | 963.36 |
| IUPAC Name | — |
| SMILES | CC1(C)c2cc(F)c[c-]c2-c2ncc([Si](C)(C)C)cc2C1(C)C.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2c3ccc3ccc4ccccc4c32)cc1C1([2H])CCCCC1.[Ir] |
| InChI | InChI=1S/C32H26NO.C20H25FNSi.Ir/c1-20-19-33-29(18-28(20)21-8-3-2-4-9-21)27-13-7-12-25-26-17-16-23-15-14-22-10-5-6-11-24(22)30(23)32(26)34-31(25)27;1-19(2)16-10-13(21)8-9-15(16)18-17(20(19,3)4)11-14(12-22-18)23(5,6)7;/h5-7,10-12,14-19,21H,2-4,8-9H2,1H3;8,10-12H,1-7H3;/q2*-1;/i1D3,21D;; |
| InChIKey | GUARMRRGRIMVDO-ZWLKRFJSSA-N |
| XLogP | 13.91 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.32 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|