C55H48F2IrN2O-2 — CID 162452652
CID 162452652 (PubChem CID 162452652) has the molecular formula C55H48F2IrN2O-2 and a molecular weight of 993.28 g/mol.
| Compound Name | CID 162452652 |
|---|---|
| PubChem CID | 162452652 |
| Molecular Formula | C55H48F2IrN2O-2 |
| Molecular Weight | 993.28 g/mol |
| Exact Mass | 993.40 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2ccc(C(C)(C)C)cn2)cc1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2c3ccc3ccc4ccccc4c32)cc1-c1ccc(C2([2H])CCC(F)(F)CC2)cc1C([2H])([2H])[2H].[Ir] |
| InChI | InChI=1S/C39H30F2NO.C16H18N.Ir/c1-23-20-28(25-16-18-39(40,41)19-17-25)13-14-29(23)34-21-35(42-22-24(34)2)33-9-5-8-31-32-15-12-27-11-10-26-6-3-4-7-30(26)36(27)38(32)43-37(31)33;1-12-5-7-13(8-6-12)15-10-9-14(11-17-15)16(2,3)4;/h3-8,10-15,20-22,25H,16-19H2,1-2H3;5-7,9-11H,1-4H3;/q2*-1;/i1D3,2D3,25D;1D3; |
| InChIKey | SQWSZJHDJZMAFI-HHXPJWMOSA-N |
| XLogP | 15.48 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.28 |
| LogP ≤ 5 | 15.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|