C56H58IrN2O-2 — CID 176846644
CID 176846644 (PubChem CID 176846644) has the molecular formula C56H58IrN2O-2 and a molecular weight of 977.37 g/mol.
| Compound Name | CID 176846644 |
|---|---|
| PubChem CID | 176846644 |
| Molecular Formula | C56H58IrN2O-2 |
| Molecular Weight | 977.37 g/mol |
| Exact Mass | 977.48 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2ccc(C(C)(C)C)cn2)cc1.[2H]C([2H])([2H])c1cnc(-c2[c-]cc(C([2H])([2H])[2H])c3c2oc2c3ccc3ccc4ccccc4c32)cc1C1([2H])CCC2(CCC(C)(C)CC2)CC1.[Ir] |
| InChI | InChI=1S/C40H40NO.C16H18N.Ir/c1-25-9-13-31(37-35(25)32-14-12-29-11-10-27-7-5-6-8-30(27)36(29)38(32)42-37)34-23-33(26(2)24-41-34)28-15-17-40(18-16-28)21-19-39(3,4)20-22-40;1-12-5-7-13(8-6-12)15-10-9-14(11-17-15)16(2,3)4;/h5-12,14,23-24,28H,15-22H2,1-4H3;5-7,9-11H,1-4H3;/q2*-1;/i1D3,2D3,28D;1D3; |
| InChIKey | HXDWBDRHNVKTNF-WOHPVHGESA-N |
| XLogP | 15.77 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.37 |
| LogP ≤ 5 | 15.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|