C35H33NO — CID 176846602
4-(1-deuterio-4,4-dimethylcyclohexyl)-5-(trideuteriomethyl)-2-[8-(trideuteriomethyl)-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaen-5-yl]pyridine (PubChem CID 176846602) has the molecular formula C35H33NO and a molecular weight of 490.70 g/mol. Its IUPAC name is 4-(1-deuterio-4,4-dimethylcyclohexyl)-5-(trideuteriomethyl)-2-[8-(trideuteriomethyl)-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaen-5-yl]pyridine.
| Compound Name | 4-(1-deuterio-4,4-dimethylcyclohexyl)-5-(trideuteriomethyl)-2-[8-(trideuteriomethyl)-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaen-5-yl]pyridine |
|---|---|
| PubChem CID | 176846602 |
| Molecular Formula | C35H33NO |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | 4-(1-deuterio-4,4-dimethylcyclohexyl)-5-(trideuteriomethyl)-2-[8-(trideuteriomethyl)-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaen-5-yl]pyridine |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2ccc(C([2H])([2H])[2H])c3c2oc2c3ccc3ccc4ccccc4c32)cc1C1([2H])CCC(C)(C)CC1 |
| InChI | InChI=1S/C35H33NO/c1-21-9-13-27(30-19-29(22(2)20-36-30)24-15-17-35(3,4)18-16-24)33-31(21)28-14-12-25-11-10-23-7-5-6-8-26(23)32(25)34(28)37-33/h5-14,19-20,24H,15-18H2,1-4H3/i1D3,2D3,24D |
| InChIKey | PVIGHQVYRXXFFU-WZSPZVGLSA-N |
| XLogP | 10.26 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|