C68H58N2O2Pt — CID 162771228
CID 162771228 (PubChem CID 162771228) has the molecular formula C68H58N2O2Pt and a molecular weight of 1140.36 g/mol.
| Compound Name | CID 162771228 |
|---|---|
| PubChem CID | 162771228 |
| Molecular Formula | C68H58N2O2Pt |
| Molecular Weight | 1140.36 g/mol |
| Exact Mass | 1139.48 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]c(Oc3[c-]c(-c4cc(-c5ccc(-c6ccc(C7([2H])CCC(C)(C)CC7)cc6C)cc5C)c(C)cn4)c4oc5c(ccc6ccc7ccccc7c65)c4c3)c(C([2H])([2H])[2H])c(-c3ccccc3)c2)cc1C([2H])([2H])[2H].[Pt+2] |
| InChI | InChI=1S/C68H58N2O2.Pt/c1-40-32-62(69-38-43(40)4)52-33-59(47-14-10-9-11-15-47)45(6)64(34-52)71-53-35-60-57-25-20-49-19-18-48-16-12-13-17-56(48)65(49)67(57)72-66(60)61(36-53)63-37-58(44(5)39-70-63)55-24-22-51(31-42(55)3)54-23-21-50(30-41(54)2)46-26-28-68(7,8)29-27-46;/h9-25,30-33,35,37-39,46H,26-29H2,1-8H3;/q-2;+2/i1D3,4D3,6D3,46D; |
| InChIKey | GMRFCAMLYXYQAB-VOALMUFISA-N |
| XLogP | 18.94 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1140.36 |
| LogP ≤ 5 | 18.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|