C69H72N2O2Pt — CID 162771188
CID 162771188 (PubChem CID 162771188) has the molecular formula C69H72N2O2Pt and a molecular weight of 1166.49 g/mol.
| Compound Name | CID 162771188 |
|---|---|
| PubChem CID | 162771188 |
| Molecular Formula | C69H72N2O2Pt |
| Molecular Weight | 1166.49 g/mol |
| Exact Mass | 1165.59 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]c(Oc3[c-]c(-c4cc(C5CCC(C)(C6CCC(C7([2H])CCC(C)(C)CC7)CC6C)CC5C)c(C)cn4)c4oc5c(ccc6ccc7ccccc7c65)c4c3)c(C([2H])([2H])[2H])c(-c3ccccc3)c2)cc1C([2H])([2H])[2H].[Pt+2] |
| InChI | InChI=1S/C69H72N2O2.Pt/c1-41-32-62(70-39-44(41)4)52-33-58(48-15-11-10-12-16-48)46(6)64(34-52)72-53-35-59-56-23-21-50-20-19-49-17-13-14-18-55(49)65(50)67(56)73-66(59)60(36-53)63-37-57(45(5)40-71-63)54-27-30-69(9,38-43(54)3)61-24-22-51(31-42(61)2)47-25-28-68(7,8)29-26-47;/h10-21,23,32-33,35,37,39-40,42-43,47,51,54,61H,22,24-31,38H2,1-9H3;/q-2;+2/i1D3,4D3,6D3,47D; |
| InChIKey | DIAYDDDUOVFREX-OXGVVZGHSA-N |
| XLogP | 19.49 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1166.49 |
| LogP ≤ 5 | 19.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|