C27H20N2O — CID 176823661
5-[4,5-bis(trideuteriomethyl)-2-pyridinyl]-18-(trideuteriomethyl)-3-oxa-17-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16(21),17,19-decaene (PubChem CID 176823661) has the molecular formula C27H20N2O and a molecular weight of 397.52 g/mol. Its IUPAC name is 5-[4,5-bis(trideuteriomethyl)-2-pyridinyl]-18-(trideuteriomethyl)-3-oxa-17-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16(21),17,19-decaene.
| Compound Name | 5-[4,5-bis(trideuteriomethyl)-2-pyridinyl]-18-(trideuteriomethyl)-3-oxa-17-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16(21),17,19-decaene |
|---|---|
| PubChem CID | 176823661 |
| Molecular Formula | C27H20N2O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 5-[4,5-bis(trideuteriomethyl)-2-pyridinyl]-18-(trideuteriomethyl)-3-oxa-17-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16(21),17,19-decaene |
| SMILES | [2H]C([2H])([2H])c1ccc2c(ccc3ccc4c5cccc(-c6cc(C([2H])([2H])[2H])c(C([2H])([2H])[2H])cn6)c5oc4c32)n1 |
| InChI | InChI=1S/C27H20N2O/c1-15-13-24(28-14-16(15)2)22-6-4-5-19-20-11-8-18-9-12-23-21(10-7-17(3)29-23)25(18)27(20)30-26(19)22/h4-14H,1-3H3/i1D3,2D3,3D3 |
| InChIKey | JEVXGUFVEBJPEY-GQALSZNTSA-N |
| XLogP | 7.27 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|