C34H39NO — CID 176590492
4-(1-deuterio-4,4-dimethylcyclohexyl)-2-(5,5,6,6-tetramethylnaphtho[1,2-b][1]benzofuran-2-yl)-5-(trideuteriomethyl)pyridine (PubChem CID 176590492) has the molecular formula C34H39NO and a molecular weight of 481.72 g/mol. Its IUPAC name is 4-(1-deuterio-4,4-dimethylcyclohexyl)-2-(5,5,6,6-tetramethylnaphtho[1,2-b][1]benzofuran-2-yl)-5-(trideuteriomethyl)pyridine.
| Compound Name | 4-(1-deuterio-4,4-dimethylcyclohexyl)-2-(5,5,6,6-tetramethylnaphtho[1,2-b][1]benzofuran-2-yl)-5-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 176590492 |
| Molecular Formula | C34H39NO |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.33 |
| IUPAC Name | 4-(1-deuterio-4,4-dimethylcyclohexyl)-2-(5,5,6,6-tetramethylnaphtho[1,2-b][1]benzofuran-2-yl)-5-(trideuteriomethyl)pyridine |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2ccc3c(c2)-c2oc4ccccc4c2C(C)(C)C3(C)C)cc1C1([2H])CCC(C)(C)CC1 |
| InChI | InChI=1S/C34H39NO/c1-21-20-35-28(19-25(21)22-14-16-32(2,3)17-15-22)23-12-13-27-26(18-23)31-30(34(6,7)33(27,4)5)24-10-8-9-11-29(24)36-31/h8-13,18-20,22H,14-17H2,1-7H3/i1D3,22D |
| InChIKey | ZAYPLZSQNUYDTG-UBBYCIKFSA-N |
| XLogP | 9.72 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |