C28H30N2O — CID 172534744
4-(3-deuteriospiro[5.5]undecan-3-yl)-2-dibenzofuran-4-yl-5-(trideuteriomethyl)pyrimidine (PubChem CID 172534744) has the molecular formula C28H30N2O and a molecular weight of 414.59 g/mol. Its IUPAC name is 4-(3-deuteriospiro[5.5]undecan-3-yl)-2-dibenzofuran-4-yl-5-(trideuteriomethyl)pyrimidine.
| Compound Name | 4-(3-deuteriospiro[5.5]undecan-3-yl)-2-dibenzofuran-4-yl-5-(trideuteriomethyl)pyrimidine |
|---|---|
| PubChem CID | 172534744 |
| Molecular Formula | C28H30N2O |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 4-(3-deuteriospiro[5.5]undecan-3-yl)-2-dibenzofuran-4-yl-5-(trideuteriomethyl)pyrimidine |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2cccc3c2oc2ccccc23)nc1C1([2H])CCC2(CCCCC2)CC1 |
| InChI | InChI=1S/C28H30N2O/c1-19-18-29-27(23-10-7-9-22-21-8-3-4-11-24(21)31-26(22)23)30-25(19)20-12-16-28(17-13-20)14-5-2-6-15-28/h3-4,7-11,18,20H,2,5-6,12-17H2,1H3/i1D3,20D |
| InChIKey | FCTBMAHXEHQUBX-SURGUCNUSA-N |
| XLogP | 7.96 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |