C28H23NO — CID 162503576
2-(1,1,2,3,3-pentadeuterio-2-phenylindeno[5,6-b][1]benzofuran-8-yl)-4,5-bis(trideuteriomethyl)pyridine (PubChem CID 162503576) has the molecular formula C28H23NO and a molecular weight of 400.57 g/mol. Its IUPAC name is 2-(1,1,2,3,3-pentadeuterio-2-phenylindeno[5,6-b][1]benzofuran-8-yl)-4,5-bis(trideuteriomethyl)pyridine.
| Compound Name | 2-(1,1,2,3,3-pentadeuterio-2-phenylindeno[5,6-b][1]benzofuran-8-yl)-4,5-bis(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 162503576 |
| Molecular Formula | C28H23NO |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 2-(1,1,2,3,3-pentadeuterio-2-phenylindeno[5,6-b][1]benzofuran-8-yl)-4,5-bis(trideuteriomethyl)pyridine |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2cccc3c2oc2cc4c(cc23)C([2H])([2H])C([2H])(c2ccccc2)C4([2H])[2H])cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C28H23NO/c1-17-11-26(29-16-18(17)2)24-10-6-9-23-25-14-21-12-20(19-7-4-3-5-8-19)13-22(21)15-27(25)30-28(23)24/h3-11,14-16,20H,12-13H2,1-2H3/i1D3,2D3,12D2,13D2,20D |
| InChIKey | BNTJQFOQTBIHEW-OMNBAEFTSA-N |
| XLogP | 7.15 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |