C31H30N2OSi — CID 172542695
6-[4,5-bis(trideuteriomethyl)-2-pyridinyl]-4-(tert-butyl-methyl-phenylsilyl)dibenzofuran-3-carbonitrile (PubChem CID 172542695) has the molecular formula C31H30N2OSi and a molecular weight of 480.72 g/mol. Its IUPAC name is 6-[4,5-bis(trideuteriomethyl)-2-pyridinyl]-4-(tert-butyl-methyl-phenylsilyl)dibenzofuran-3-carbonitrile.
| Compound Name | 6-[4,5-bis(trideuteriomethyl)-2-pyridinyl]-4-(tert-butyl-methyl-phenylsilyl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 172542695 |
| Molecular Formula | C31H30N2OSi |
| Molecular Weight | 480.72 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 6-[4,5-bis(trideuteriomethyl)-2-pyridinyl]-4-(tert-butyl-methyl-phenylsilyl)dibenzofuran-3-carbonitrile |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2cccc3c2oc2c([Si](C)(c4ccccc4)C(C)(C)C)c(C#N)ccc23)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C31H30N2OSi/c1-20-17-27(33-19-21(20)2)26-14-10-13-24-25-16-15-22(18-32)30(29(25)34-28(24)26)35(6,31(3,4)5)23-11-8-7-9-12-23/h7-17,19H,1-6H3/i1D3,2D3 |
| InChIKey | ZZSDUAFZRLVXNC-WFGJKAKNSA-N |
| XLogP | 7.13 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.72 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|