C36H35NOSi — CID 172542664
[6-[4-(1,1-dideuterio-2,2-dimethylpropyl)-5-(trideuteriomethyl)-2-pyridinyl]dibenzofuran-4-yl]-methyl-diphenylsilane (PubChem CID 172542664) has the molecular formula C36H35NOSi and a molecular weight of 530.80 g/mol. Its IUPAC name is [6-[4-(1,1-dideuterio-2,2-dimethylpropyl)-5-(trideuteriomethyl)-2-pyridinyl]dibenzofuran-4-yl]-methyl-diphenylsilane.
| Compound Name | [6-[4-(1,1-dideuterio-2,2-dimethylpropyl)-5-(trideuteriomethyl)-2-pyridinyl]dibenzofuran-4-yl]-methyl-diphenylsilane |
|---|---|
| PubChem CID | 172542664 |
| Molecular Formula | C36H35NOSi |
| Molecular Weight | 530.80 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | [6-[4-(1,1-dideuterio-2,2-dimethylpropyl)-5-(trideuteriomethyl)-2-pyridinyl]dibenzofuran-4-yl]-methyl-diphenylsilane |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2cccc3c2oc2c([Si](C)(c4ccccc4)c4ccccc4)cccc23)cc1C([2H])([2H])C(C)(C)C |
| InChI | InChI=1S/C36H35NOSi/c1-25-24-37-32(22-26(25)23-36(2,3)4)31-20-12-18-29-30-19-13-21-33(35(30)38-34(29)31)39(5,27-14-8-6-9-15-27)28-16-10-7-11-17-28/h6-22,24H,23H2,1-5H3/i1D3,23D2 |
| InChIKey | ZTALHKHJVSURKV-ZUMJPWLISA-N |
| XLogP | 7.65 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.80 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|