C55H49FIrN2O-2 — CID 169301276
CID 169301276 (PubChem CID 169301276) has the molecular formula C55H49FIrN2O-2 and a molecular weight of 974.28 g/mol.
| Compound Name | CID 169301276 |
|---|---|
| PubChem CID | 169301276 |
| Molecular Formula | C55H49FIrN2O-2 |
| Molecular Weight | 974.28 g/mol |
| Exact Mass | 974.40 |
| IUPAC Name | — |
| SMILES | CC1(C)c2cc(F)c[c-]c2-c2ncccc2C1(C)C.[2H]c1cc(C([2H])([2H])C(C)(C)C)cc(C([2H])([2H])[2H])c1-c1cc(-c2[c-]ccc3c2oc2c3ccc3ccc4ccccc4c32)ncc1C([2H])([2H])[2H].[Ir] |
| InChI | InChI=1S/C38H32NO.C17H17FN.Ir/c1-23-19-25(21-38(3,4)5)13-17-28(23)33-20-34(39-22-24(33)2)32-12-8-11-30-31-18-16-27-15-14-26-9-6-7-10-29(26)35(27)37(31)40-36(30)32;1-16(2)13-6-5-9-19-15(13)12-8-7-11(18)10-14(12)17(16,3)4;/h6-11,13-20,22H,21H2,1-5H3;5-7,9-10H,1-4H3;/q2*-1;/i1D3,2D3,17D,21D2;; |
| InChIKey | JBGUBKMDJQTIPQ-YFIMXPIQSA-N |
| XLogP | 14.88 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.28 |
| LogP ≤ 5 | 14.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|