C42H34GeIrN2S-2 — CID 166578907
iridium;3-(1-phenyl-3H-dibenzothiophen-3-id-4-yl)isoquinoline;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)germane (PubChem CID 166578907) has the molecular formula C42H34GeIrN2S-2 and a molecular weight of 863.64 g/mol. Its IUPAC name is iridium;3-(1-phenyl-3H-dibenzothiophen-3-id-4-yl)isoquinoline;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)germane.
| Compound Name | iridium;3-(1-phenyl-3H-dibenzothiophen-3-id-4-yl)isoquinoline;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 166578907 |
| Molecular Formula | C42H34GeIrN2S-2 |
| Molecular Weight | 863.64 g/mol |
| Exact Mass | 865.13 |
| IUPAC Name | iridium;3-(1-phenyl-3H-dibenzothiophen-3-id-4-yl)isoquinoline;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)germane |
| SMILES | Cc1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C.[Ir].[c-]1cc(-c2ccccc2)c2c(sc3ccccc32)c1-c1cc2ccccc2cn1 |
| InChI | InChI=1S/C27H16NS.C15H18GeN.Ir/c1-2-8-18(9-3-1)21-14-15-22(24-16-19-10-4-5-11-20(19)17-28-24)27-26(21)23-12-6-7-13-25(23)29-27;1-12-10-15(13-8-6-5-7-9-13)17-11-14(12)16(2,3)4;/h1-14,16-17H;5-8,10-11H,1-4H3;/q2*-1; |
| InChIKey | CFBHSZQEMPTTLZ-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.64 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|