C25H19BrIrN — CID 162483813
2-(3-bromobenzene-6-id-1-yl)-4-methylpyridine;iridium(3+);1-methyl-3-phenylbenzene-4-ide (PubChem CID 162483813) has the molecular formula C25H19BrIrN and a molecular weight of 605.56 g/mol. Its IUPAC name is 2-(3-bromobenzene-6-id-1-yl)-4-methylpyridine;iridium(3+);1-methyl-3-phenylbenzene-4-ide.
| Compound Name | 2-(3-bromobenzene-6-id-1-yl)-4-methylpyridine;iridium(3+);1-methyl-3-phenylbenzene-4-ide |
|---|---|
| PubChem CID | 162483813 |
| Molecular Formula | C25H19BrIrN |
| Molecular Weight | 605.56 g/mol |
| Exact Mass | 605.03 |
| IUPAC Name | 2-(3-bromobenzene-6-id-1-yl)-4-methylpyridine;iridium(3+);1-methyl-3-phenylbenzene-4-ide |
| SMILES | Cc1cc[c-]c(-c2[c-]cccc2)c1.Cc1ccnc(-c2[c-]ccc(Br)c2)c1.[Ir+3] |
| InChI | InChI=1S/C13H10.C12H9BrN.Ir/c1-11-6-5-9-13(10-11)12-7-3-2-4-8-12;1-9-5-6-14-12(7-9)10-3-2-4-11(13)8-10;/h2-7,10H,1H3;2,4-8H,1H3;/q-2;-1;+3 |
| InChIKey | DTWXWRKMDNRAHB-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.56 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|