C23H15BrIrN3- — CID 58720836
2-(3-bromobenzene-6-id-1-yl)pyridine;iridium;1,10-phenanthroline (PubChem CID 58720836) has the molecular formula C23H15BrIrN3- and a molecular weight of 605.52 g/mol. Its IUPAC name is 2-(3-bromobenzene-6-id-1-yl)pyridine;iridium;1,10-phenanthroline.
| Compound Name | 2-(3-bromobenzene-6-id-1-yl)pyridine;iridium;1,10-phenanthroline |
|---|---|
| PubChem CID | 58720836 |
| Molecular Formula | C23H15BrIrN3- |
| Molecular Weight | 605.52 g/mol |
| Exact Mass | 605.01 |
| IUPAC Name | 2-(3-bromobenzene-6-id-1-yl)pyridine;iridium;1,10-phenanthroline |
| SMILES | Brc1cc[c-]c(-c2ccccn2)c1.[Ir].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C11H7BrN.Ir/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;12-10-5-3-4-9(8-10)11-6-1-2-7-13-11;/h1-8H;1-3,5-8H;/q;-1; |
| InChIKey | NZQKIYVMAULIPL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|