C12H7BrIrN- — CID 59340216
CID 59340216 (PubChem CID 59340216) has the molecular formula C12H7BrIrN- and a molecular weight of 437.32 g/mol.
| Compound Name | CID 59340216 |
|---|---|
| PubChem CID | 59340216 |
| Molecular Formula | C12H7BrIrN- |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.94 |
| IUPAC Name | — |
| SMILES | [CH]c1cccc(-c2[c-]ccc(Br)c2)n1.[Ir] |
| InChI | InChI=1S/C12H7BrN.Ir/c1-9-4-2-7-12(14-9)10-5-3-6-11(13)8-10;/h1-4,6-8H;/q-1; |
| InChIKey | BUZCWXLPMHIRQD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|