C16H16IrN- — CID 168812316
4-[(E)-but-2-en-2-yl]-2-(3-methylbenzene-6-id-1-yl)pyridine;iridium (PubChem CID 168812316) has the molecular formula C16H16IrN- and a molecular weight of 414.53 g/mol. Its IUPAC name is 4-[(E)-but-2-en-2-yl]-2-(3-methylbenzene-6-id-1-yl)pyridine;iridium.
| Compound Name | 4-[(E)-but-2-en-2-yl]-2-(3-methylbenzene-6-id-1-yl)pyridine;iridium |
|---|---|
| PubChem CID | 168812316 |
| Molecular Formula | C16H16IrN- |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 4-[(E)-but-2-en-2-yl]-2-(3-methylbenzene-6-id-1-yl)pyridine;iridium |
| SMILES | C/C=C(\C)c1ccnc(-c2[c-]ccc(C)c2)c1.[Ir] |
| InChI | InChI=1S/C16H16N.Ir/c1-4-13(3)14-8-9-17-16(11-14)15-7-5-6-12(2)10-15;/h4-6,8-11H,1-3H3;/q-1;/b13-4+; |
| InChIKey | ISDRAXVAAZUERR-GAYQJXMFSA-N |
| XLogP | 4.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|