C33H31GeIrN3O-2 — CID 162776734
iridium;8-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)germane (PubChem CID 162776734) has the molecular formula C33H31GeIrN3O-2 and a molecular weight of 750.46 g/mol. Its IUPAC name is iridium;8-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)germane.
| Compound Name | iridium;8-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 162776734 |
| Molecular Formula | C33H31GeIrN3O-2 |
| Molecular Weight | 750.46 g/mol |
| Exact Mass | 752.13 |
| IUPAC Name | iridium;8-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)germane |
| SMILES | CC(C)c1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C.[Ir].[c-]1ccc2c(oc3ncccc32)c1-c1ccccn1 |
| InChI | InChI=1S/C17H22GeN.C16H9N2O.Ir/c1-13(2)15-11-17(14-9-7-6-8-10-14)19-12-16(15)18(3,4)5;1-2-9-17-14(8-1)13-6-3-5-11-12-7-4-10-18-16(12)19-15(11)13;/h6-9,11-13H,1-5H3;1-5,7-10H;/q2*-1; |
| InChIKey | GPSZQJKUFDCJGW-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.46 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|