C18H18IrN- — CID 21044157
10,10-dimethyl-5-phenyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene;iridium (PubChem CID 21044157) has the molecular formula C18H18IrN- and a molecular weight of 440.57 g/mol. Its IUPAC name is 10,10-dimethyl-5-phenyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene;iridium.
| Compound Name | 10,10-dimethyl-5-phenyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene;iridium |
|---|---|
| PubChem CID | 21044157 |
| Molecular Formula | C18H18IrN- |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 10,10-dimethyl-5-phenyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene;iridium |
| SMILES | CC1(C)C2Cc3cc(-c4[c-]cccc4)ncc3C1C2.[Ir] |
| InChI | InChI=1S/C18H18N.Ir/c1-18(2)14-8-13-9-17(12-6-4-3-5-7-12)19-11-15(13)16(18)10-14;/h3-6,9,11,14,16H,8,10H2,1-2H3;/q-1; |
| InChIKey | KHOVCCGKOSEEDK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|