C41H45IrN3OSi-2 — CID 155610503
4-[5-(cyclopentylmethyl)-4-methyl-2-pyridinyl]-3H-[1]benzofuro[3,2-c]pyridin-3-ide;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 155610503) has the molecular formula C41H45IrN3OSi-2 and a molecular weight of 816.13 g/mol. Its IUPAC name is 4-[5-(cyclopentylmethyl)-4-methyl-2-pyridinyl]-3H-[1]benzofuro[3,2-c]pyridin-3-ide;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | 4-[5-(cyclopentylmethyl)-4-methyl-2-pyridinyl]-3H-[1]benzofuro[3,2-c]pyridin-3-ide;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 155610503 |
| Molecular Formula | C41H45IrN3OSi-2 |
| Molecular Weight | 816.13 g/mol |
| Exact Mass | 816.30 |
| IUPAC Name | 4-[5-(cyclopentylmethyl)-4-methyl-2-pyridinyl]-3H-[1]benzofuro[3,2-c]pyridin-3-ide;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.Cc1cc(-c2[c-]ncc3c2oc2ccccc23)ncc1CC1CCCC1.[Ir] |
| InChI | InChI=1S/C23H21N2O.C18H24NSi.Ir/c1-15-10-21(25-12-17(15)11-16-6-2-3-7-16)20-14-24-13-19-18-8-4-5-9-22(18)26-23(19)20;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h4-5,8-10,12-13,16H,2-3,6-7,11H2,1H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | JYRXISFHMRCRMJ-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.13 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|