C50H55IrN5OSi2-2 — CID 176651972
CID 176651972 (PubChem CID 176651972) has the molecular formula C50H55IrN5OSi2-2 and a molecular weight of 994.44 g/mol.
| Compound Name | CID 176651972 |
|---|---|
| PubChem CID | 176651972 |
| Molecular Formula | C50H55IrN5OSi2-2 |
| Molecular Weight | 994.44 g/mol |
| Exact Mass | 994.38 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)c1cc(-c2[c-]cnc([Si](C)(C)C)n2)ncn1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)cc1C1([2H])CC(C)(C)CC(C)(C)C1.[Ir] |
| InChI | InChI=1S/C36H34NO.C14H21N4Si2.Ir/c1-22-20-37-32(16-29(22)25-18-35(2,3)21-36(4,5)19-25)28-12-8-11-27-31-15-24-14-13-23-9-6-7-10-26(23)30(24)17-33(31)38-34(27)28;1-19(2,3)13-9-12(16-10-17-13)11-7-8-15-14(18-11)20(4,5)6;/h6-11,13-17,20,25H,18-19,21H2,1-5H3;8-10H,1-6H3;/q2*-1;/i1D3,25D;; |
| InChIKey | FXBUTQBCHUIVEL-AQEKSGMYSA-N |
| XLogP | 12.20 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 994.44 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|