C48H42IrN- — CID 164702463
2-[3-[3-[3-[4-(1,3-diphenylheptan-3-yl)phenyl]phenyl]phenyl]benzene-6-id-1-yl]pyridine;iridium (PubChem CID 164702463) has the molecular formula C48H42IrN- and a molecular weight of 825.09 g/mol. Its IUPAC name is 2-[3-[3-[3-[4-(1,3-diphenylheptan-3-yl)phenyl]phenyl]phenyl]benzene-6-id-1-yl]pyridine;iridium.
| Compound Name | 2-[3-[3-[3-[4-(1,3-diphenylheptan-3-yl)phenyl]phenyl]phenyl]benzene-6-id-1-yl]pyridine;iridium |
|---|---|
| PubChem CID | 164702463 |
| Molecular Formula | C48H42IrN- |
| Molecular Weight | 825.09 g/mol |
| Exact Mass | 825.30 |
| IUPAC Name | 2-[3-[3-[3-[4-(1,3-diphenylheptan-3-yl)phenyl]phenyl]phenyl]benzene-6-id-1-yl]pyridine;iridium |
| SMILES | CCCCC(CCc1ccccc1)(c1ccccc1)c1ccc(-c2cccc(-c3cccc(-c4cc[c-]c(-c5ccccn5)c4)c3)c2)cc1.[Ir] |
| InChI | InChI=1S/C48H42N.Ir/c1-2-3-31-48(45-23-8-5-9-24-45,32-30-37-15-6-4-7-16-37)46-28-26-38(27-29-46)39-17-12-18-40(34-39)41-19-13-20-42(35-41)43-21-14-22-44(36-43)47-25-10-11-33-49-47;/h4-21,23-29,33-36H,2-3,30-32H2,1H3;/q-1; |
| InChIKey | VULXXAQAWBOIMI-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.09 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|