C33H27F3IrN2O3S-2 — CID 59800869
iridium;2-[3-[3-(2-methylpropyl)phenyl]benzene-6-id-1-yl]pyridine;(3-pyridin-2-ylbenzene-4-id-1-yl) trifluoromethanesulfonate (PubChem CID 59800869) has the molecular formula C33H27F3IrN2O3S-2 and a molecular weight of 780.87 g/mol. Its IUPAC name is iridium;2-[3-[3-(2-methylpropyl)phenyl]benzene-6-id-1-yl]pyridine;(3-pyridin-2-ylbenzene-4-id-1-yl) trifluoromethanesulfonate.
| Compound Name | iridium;2-[3-[3-(2-methylpropyl)phenyl]benzene-6-id-1-yl]pyridine;(3-pyridin-2-ylbenzene-4-id-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59800869 |
| Molecular Formula | C33H27F3IrN2O3S-2 |
| Molecular Weight | 780.87 g/mol |
| Exact Mass | 781.13 |
| IUPAC Name | iridium;2-[3-[3-(2-methylpropyl)phenyl]benzene-6-id-1-yl]pyridine;(3-pyridin-2-ylbenzene-4-id-1-yl) trifluoromethanesulfonate |
| SMILES | CC(C)Cc1cccc(-c2cc[c-]c(-c3ccccn3)c2)c1.O=S(=O)(Oc1cc[c-]c(-c2ccccn2)c1)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C21H20N.C12H7F3NO3S.Ir/c1-16(2)13-17-7-5-8-18(14-17)19-9-6-10-20(15-19)21-11-3-4-12-22-21;13-12(14,15)20(17,18)19-10-5-3-4-9(8-10)11-6-1-2-7-16-11;/h3-9,11-12,14-16H,13H2,1-2H3;1-3,5-8H;/q2*-1; |
| InChIKey | BHPALWSREBBMFT-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.87 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|