C24H20IrNO2Se- — CID 166039650
(Z)-4-hydroxypent-3-en-2-one;iridium;2-phenyl-5-phenylselenopheno[3,2-b]pyridine (PubChem CID 166039650) has the molecular formula C24H20IrNO2Se- and a molecular weight of 625.61 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenyl-5-phenylselenopheno[3,2-b]pyridine.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenyl-5-phenylselenopheno[3,2-b]pyridine |
|---|---|
| PubChem CID | 166039650 |
| Molecular Formula | C24H20IrNO2Se- |
| Molecular Weight | 625.61 g/mol |
| Exact Mass | 627.03 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenyl-5-phenylselenopheno[3,2-b]pyridine |
| SMILES | CC(=O)/C=C(/C)O.[Ir].[c-]1ccccc1-c1ccc2[se]c(-c3ccccc3)cc2n1 |
| InChI | InChI=1S/C19H12NSe.C5H8O2.Ir/c1-3-7-14(8-4-1)16-11-12-18-17(20-16)13-19(21-18)15-9-5-2-6-10-15;1-4(6)3-5(2)7;/h1-7,9-13H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | WCIZVZWMEGDJCK-LWFKIUJUSA-N |
| XLogP | 5.46 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|