C27H20IrNO3- — CID 154625724
(Z)-4-hydroxypent-3-en-2-one;iridium;3-phenylindeno[2,1-f]quinolin-11-one (PubChem CID 154625724) has the molecular formula C27H20IrNO3- and a molecular weight of 598.68 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;3-phenylindeno[2,1-f]quinolin-11-one.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;3-phenylindeno[2,1-f]quinolin-11-one |
|---|---|
| PubChem CID | 154625724 |
| Molecular Formula | C27H20IrNO3- |
| Molecular Weight | 598.68 g/mol |
| Exact Mass | 599.11 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;3-phenylindeno[2,1-f]quinolin-11-one |
| SMILES | CC(=O)/C=C(/C)O.O=C1c2ccccc2-c2ccc3nc(-c4[c-]cccc4)ccc3c21.[Ir] |
| InChI | InChI=1S/C22H12NO.C5H8O2.Ir/c24-22-17-9-5-4-8-15(17)16-10-13-20-18(21(16)22)11-12-19(23-20)14-6-2-1-3-7-14;1-4(6)3-5(2)7;/h1-6,8-13H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | VRURVOMIENEGIV-LWFKIUJUSA-N |
| XLogP | 5.95 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|