C16H19NOS — CID 129059805
(E)-7-(1,3-benzothiazol-2-yl)-2,2-dimethylhept-6-en-3-one (PubChem CID 129059805) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is (E)-7-(1,3-benzothiazol-2-yl)-2,2-dimethylhept-6-en-3-one.
| Compound Name | (E)-7-(1,3-benzothiazol-2-yl)-2,2-dimethylhept-6-en-3-one |
|---|---|
| PubChem CID | 129059805 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (E)-7-(1,3-benzothiazol-2-yl)-2,2-dimethylhept-6-en-3-one |
| SMILES | CC(C)(C)C(=O)CC/C=C/c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H19NOS/c1-16(2,3)14(18)10-6-7-11-15-17-12-8-4-5-9-13(12)19-15/h4-5,7-9,11H,6,10H2,1-3H3/b11-7+ |
| InChIKey | ZEAIQBWRMQIZSO-YRNVUSSQSA-N |
| XLogP | 4.70 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |