C19H15F3N2OS — CID 134047382
(E)-3-(1,3-benzothiazol-2-yl)-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-enamide (PubChem CID 134047382) has the molecular formula C19H15F3N2OS and a molecular weight of 376.40 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 134047382 |
| Molecular Formula | C19H15F3N2OS |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
| SMILES | CN(Cc1ccccc1C(F)(F)F)C(=O)/C=C/c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H15F3N2OS/c1-24(12-13-6-2-3-7-14(13)19(20,21)22)18(25)11-10-17-23-15-8-4-5-9-16(15)26-17/h2-11H,12H2,1H3/b11-10+ |
| InChIKey | IRZGFDXNKKTUBR-ZHACJKMWSA-N |
| XLogP | 4.99 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|