C17H20N2OS — CID 76857537
3-(1,3-benzothiazol-2-yl)-N-cyclohexyl-N-methylprop-2-enamide (PubChem CID 76857537) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-cyclohexyl-N-methylprop-2-enamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-cyclohexyl-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 76857537 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-cyclohexyl-N-methylprop-2-enamide |
| SMILES | CN(C(=O)C=Cc1nc2ccccc2s1)C1CCCCC1 |
| InChI | InChI=1S/C17H20N2OS/c1-19(13-7-3-2-4-8-13)17(20)12-11-16-18-14-9-5-6-10-15(14)21-16/h5-6,9-13H,2-4,7-8H2,1H3 |
| InChIKey | SXXXMIVIJKXBHX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|