C24H17N3OS2 — CID 55333731
(E)-N,3-bis(1,3-benzothiazol-2-yl)-N-(2-methylphenyl)prop-2-enamide (PubChem CID 55333731) has the molecular formula C24H17N3OS2 and a molecular weight of 427.55 g/mol. Its IUPAC name is (E)-N,3-bis(1,3-benzothiazol-2-yl)-N-(2-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N,3-bis(1,3-benzothiazol-2-yl)-N-(2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55333731 |
| Molecular Formula | C24H17N3OS2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | (E)-N,3-bis(1,3-benzothiazol-2-yl)-N-(2-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccccc1N(C(=O)/C=C/c1nc2ccccc2s1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H17N3OS2/c1-16-8-2-5-11-19(16)27(24-26-18-10-4-7-13-21(18)30-24)23(28)15-14-22-25-17-9-3-6-12-20(17)29-22/h2-15H,1H3/b15-14+ |
| InChIKey | HBYMASATSFLCCY-CCEZHUSRSA-N |
| XLogP | 6.59 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|