C24H20N2OS — CID 8895298
(E)-3-(1,3-benzothiazol-2-yl)-N-benzyl-N-(3-methylphenyl)prop-2-enamide (PubChem CID 8895298) has the molecular formula C24H20N2OS and a molecular weight of 384.50 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-benzyl-N-(3-methylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-benzyl-N-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8895298 |
| Molecular Formula | C24H20N2OS |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-benzyl-N-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(N(Cc2ccccc2)C(=O)/C=C/c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C24H20N2OS/c1-18-8-7-11-20(16-18)26(17-19-9-3-2-4-10-19)24(27)15-14-23-25-21-12-5-6-13-22(21)28-23/h2-16H,17H2,1H3/b15-14+ |
| InChIKey | HAVNCWLLRHZXSE-CCEZHUSRSA-N |
| XLogP | 5.85 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|