C22H16ClN3OS — CID 55889080
(E)-3-(1,3-benzothiazol-2-yl)-N-(4-chlorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide (PubChem CID 55889080) has the molecular formula C22H16ClN3OS and a molecular weight of 405.91 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-(4-chlorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-(4-chlorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 55889080 |
| Molecular Formula | C22H16ClN3OS |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-(4-chlorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)N(Cc1ccccn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16ClN3OS/c23-16-8-10-18(11-9-16)26(15-17-5-3-4-14-24-17)22(27)13-12-21-25-19-6-1-2-7-20(19)28-21/h1-14H,15H2/b13-12+ |
| InChIKey | SKZZHVPAGFOUCI-OUKQBFOZSA-N |
| XLogP | 5.59 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|