C22H15F2N3OS — CID 55889362
(E)-3-(1,3-benzothiazol-2-yl)-N-(2,4-difluorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide (PubChem CID 55889362) has the molecular formula C22H15F2N3OS and a molecular weight of 407.45 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-(2,4-difluorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-(2,4-difluorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 55889362 |
| Molecular Formula | C22H15F2N3OS |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-(2,4-difluorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)N(Cc1ccccn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H15F2N3OS/c23-15-8-9-19(17(24)13-15)27(14-16-5-3-4-12-25-16)22(28)11-10-21-26-18-6-1-2-7-20(18)29-21/h1-13H,14H2/b11-10+ |
| InChIKey | BTXRBCIBFSAXOM-ZHACJKMWSA-N |
| XLogP | 5.22 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|