C18H11Cl2F2N3O — CID 55890396
5,6-dichloro-N-(2,4-difluorophenyl)-N-(pyridin-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 55890396) has the molecular formula C18H11Cl2F2N3O and a molecular weight of 394.21 g/mol. Its IUPAC name is 5,6-dichloro-N-(2,4-difluorophenyl)-N-(pyridin-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-(2,4-difluorophenyl)-N-(pyridin-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55890396 |
| Molecular Formula | C18H11Cl2F2N3O |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 5,6-dichloro-N-(2,4-difluorophenyl)-N-(pyridin-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(c1cnc(Cl)c(Cl)c1)N(Cc1ccccn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H11Cl2F2N3O/c19-14-7-11(9-24-17(14)20)18(26)25(10-13-3-1-2-6-23-13)16-5-4-12(21)8-15(16)22/h1-9H,10H2 |
| InChIKey | DCJCRXXONSVFIP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|