C23H22F2N2O3 — CID 55890261
N-(2,4-difluorophenyl)-4-(4-methoxyphenoxy)-N-(pyridin-2-ylmethyl)butanamide (PubChem CID 55890261) has the molecular formula C23H22F2N2O3 and a molecular weight of 412.44 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(4-methoxyphenoxy)-N-(pyridin-2-ylmethyl)butanamide.
| Compound Name | N-(2,4-difluorophenyl)-4-(4-methoxyphenoxy)-N-(pyridin-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 55890261 |
| Molecular Formula | C23H22F2N2O3 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(4-methoxyphenoxy)-N-(pyridin-2-ylmethyl)butanamide |
| SMILES | COc1ccc(OCCCC(=O)N(Cc2ccccn2)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C23H22F2N2O3/c1-29-19-8-10-20(11-9-19)30-14-4-6-23(28)27(16-18-5-2-3-13-26-18)22-12-7-17(24)15-21(22)25/h2-3,5,7-13,15H,4,6,14,16H2,1H3 |
| InChIKey | VJJCZLLBQOSXNI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|