C23H17F2N3O3 — CID 55890007
N-(2,4-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-N-(pyridin-2-ylmethyl)propanamide (PubChem CID 55890007) has the molecular formula C23H17F2N3O3 and a molecular weight of 421.40 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-N-(pyridin-2-ylmethyl)propanamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-N-(pyridin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 55890007 |
| Molecular Formula | C23H17F2N3O3 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-N-(pyridin-2-ylmethyl)propanamide |
| SMILES | CC(C(=O)N(Cc1ccccn1)c1ccc(F)cc1F)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H17F2N3O3/c1-14(28-22(30)17-7-2-3-8-18(17)23(28)31)21(29)27(13-16-6-4-5-11-26-16)20-10-9-15(24)12-19(20)25/h2-12,14H,13H2,1H3 |
| InChIKey | PBLDAUVKUJVCSM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|