C22H23N3O3S2 — CID 55495121
[1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 55495121) has the molecular formula C22H23N3O3S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is [1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | [1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55495121 |
| Molecular Formula | C22H23N3O3S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1nc2ccccc2s1)C(=O)N(c1nccs1)C1CCCCC1 |
| InChI | InChI=1S/C22H23N3O3S2/c1-15(21(27)25(22-23-13-14-29-22)16-7-3-2-4-8-16)28-20(26)12-11-19-24-17-9-5-6-10-18(17)30-19/h5-6,9-16H,2-4,7-8H2,1H3/b12-11+ |
| InChIKey | HBQBWBPREYSMFG-VAWYXSNFSA-N |
| XLogP | 5.06 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|