C20H24N2O4S — CID 18267986
[1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] (E)-3-(5-methylfuran-2-yl)prop-2-enoate (PubChem CID 18267986) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is [1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] (E)-3-(5-methylfuran-2-yl)prop-2-enoate.
| Compound Name | [1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] (E)-3-(5-methylfuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 18267986 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | [1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] (E)-3-(5-methylfuran-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)OC(C)C(=O)N(c2nccs2)C2CCCCC2)o1 |
| InChI | InChI=1S/C20H24N2O4S/c1-14-8-9-17(25-14)10-11-18(23)26-15(2)19(24)22(20-21-12-13-27-20)16-6-4-3-5-7-16/h8-13,15-16H,3-7H2,1-2H3/b11-10+ |
| InChIKey | RGHZJFKIQPIXML-ZHACJKMWSA-N |
| XLogP | 4.36 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|