C21H23N3O7S — CID 42932154
[1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 42932154) has the molecular formula C21H23N3O7S and a molecular weight of 461.50 g/mol. Its IUPAC name is [1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | [1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 42932154 |
| Molecular Formula | C21H23N3O7S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | [1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | CC(OC(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2)C(=O)N(c1nccs1)C1CCCCC1 |
| InChI | InChI=1S/C21H23N3O7S/c1-13(19(25)23(21-22-7-10-32-21)14-5-3-2-4-6-14)31-20(26)15-11-17-18(30-9-8-29-17)12-16(15)24(27)28/h7,10-14H,2-6,8-9H2,1H3 |
| InChIKey | UMPZJRPEEMBREU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 121.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|