C12H13NO6S — CID 71471192
methyl 9-nitro-2,3,5,6-tetrahydro-1,7,4-benzodioxathionine-10-carboxylate (PubChem CID 71471192) has the molecular formula C12H13NO6S and a molecular weight of 299.30 g/mol. Its IUPAC name is methyl 9-nitro-2,3,5,6-tetrahydro-1,7,4-benzodioxathionine-10-carboxylate.
| Compound Name | methyl 9-nitro-2,3,5,6-tetrahydro-1,7,4-benzodioxathionine-10-carboxylate |
|---|---|
| PubChem CID | 71471192 |
| Molecular Formula | C12H13NO6S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | methyl 9-nitro-2,3,5,6-tetrahydro-1,7,4-benzodioxathionine-10-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1[N+](=O)[O-])OCCSCCO2 |
| InChI | InChI=1S/C12H13NO6S/c1-17-12(14)8-6-10-11(7-9(8)13(15)16)19-3-5-20-4-2-18-10/h6-7H,2-5H2,1H3 |
| InChIKey | GQCAJCJFBUQVFP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|