C13H11NO8 — CID 7594952
[(3R)-2-oxooxolan-3-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 7594952) has the molecular formula C13H11NO8 and a molecular weight of 309.23 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 7594952 |
| Molecular Formula | C13H11NO8 |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | O=C(O[C@@H]1CCOC1=O)c1cc2c(cc1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C13H11NO8/c15-12(22-9-1-2-21-13(9)16)7-5-10-11(20-4-3-19-10)6-8(7)14(17)18/h5-6,9H,1-4H2/t9-/m1/s1 |
| InChIKey | DSVRRVLOPSQHIL-SECBINFHSA-N |
| XLogP | 0.84 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|