C15H17NOS — CID 143177403
(1E,5Z)-1-(1,3-benzothiazol-2-yl)-4-methylhepta-1,5-dien-4-ol (PubChem CID 143177403) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is (1E,5Z)-1-(1,3-benzothiazol-2-yl)-4-methylhepta-1,5-dien-4-ol.
| Compound Name | (1E,5Z)-1-(1,3-benzothiazol-2-yl)-4-methylhepta-1,5-dien-4-ol |
|---|---|
| PubChem CID | 143177403 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (1E,5Z)-1-(1,3-benzothiazol-2-yl)-4-methylhepta-1,5-dien-4-ol |
| SMILES | C/C=C\C(C)(O)C/C=C/c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H17NOS/c1-3-10-15(2,17)11-6-9-14-16-12-7-4-5-8-13(12)18-14/h3-10,17H,11H2,1-2H3/b9-6+,10-3- |
| InChIKey | DWKQFOBYNUMVOY-JORGAUELSA-N |
| XLogP | 4.03 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|