C25H27F3N4O — CID 162787974
N-quinolin-3-yl-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentanamide (PubChem CID 162787974) has the molecular formula C25H27F3N4O and a molecular weight of 456.51 g/mol. Its IUPAC name is N-quinolin-3-yl-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentanamide.
| Compound Name | N-quinolin-3-yl-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentanamide |
|---|---|
| PubChem CID | 162787974 |
| Molecular Formula | C25H27F3N4O |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | N-quinolin-3-yl-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentanamide |
| SMILES | O=C(CCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C25H27F3N4O/c26-25(27,28)20-7-5-8-22(17-20)32-14-12-31(13-15-32)11-4-3-10-24(33)30-21-16-19-6-1-2-9-23(19)29-18-21/h1-2,5-9,16-18H,3-4,10-15H2,(H,30,33) |
| InChIKey | ZXTOYAVOALDAPA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|