C23H30F3N5OS — CID 112824562
1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]urea (PubChem CID 112824562) has the molecular formula C23H30F3N5OS and a molecular weight of 481.59 g/mol. Its IUPAC name is 1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]urea.
| Compound Name | 1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]urea |
|---|---|
| PubChem CID | 112824562 |
| Molecular Formula | C23H30F3N5OS |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]urea |
| SMILES | O=C(NCCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1)Nc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C23H30F3N5OS/c24-23(25,26)17-6-5-7-18(16-17)31-14-12-30(13-15-31)11-4-3-10-27-21(32)29-22-28-19-8-1-2-9-20(19)33-22/h5-7,16H,1-4,8-15H2,(H2,27,28,29,32) |
| InChIKey | NRIXFWRVJJHXSN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|